C17H23ClN4O — CID 110497753
5-chloro-1-ethyl-3-methyl-N-(4-methylpiperazin-1-yl)indole-2-carboxamide (PubChem CID 110497753) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 5-chloro-1-ethyl-3-methyl-N-(4-methylpiperazin-1-yl)indole-2-carboxamide.
| Compound Name | 5-chloro-1-ethyl-3-methyl-N-(4-methylpiperazin-1-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 110497753 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 5-chloro-1-ethyl-3-methyl-N-(4-methylpiperazin-1-yl)indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NN2CCN(C)CC2)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H23ClN4O/c1-4-22-15-6-5-13(18)11-14(15)12(2)16(22)17(23)19-21-9-7-20(3)8-10-21/h5-6,11H,4,7-10H2,1-3H3,(H,19,23) |
| InChIKey | MYWWWFUITQMEOJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|