C18H16Cl2N2O — CID 110501443
N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide (PubChem CID 110501443) has the molecular formula C18H16Cl2N2O and a molecular weight of 347.25 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 110501443 |
| Molecular Formula | C18H16Cl2N2O |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-ethyl-3-methylindole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2cc(Cl)cc(Cl)c2)c(C)c2ccccc21 |
| InChI | InChI=1S/C18H16Cl2N2O/c1-3-22-16-7-5-4-6-15(16)11(2)17(22)18(23)21-14-9-12(19)8-13(20)10-14/h4-10H,3H2,1-2H3,(H,21,23) |
| InChIKey | JMGPFHJNSXRENC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|