C28H30N2O3S — CID 110503561
methyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 110503561) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is methyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503561 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | methyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCCCn1c(C(=O)Nc2sc(C)c(-c3ccc(C)cc3)c2C(=O)OC)c(C)c2ccccc21 |
| InChI | InChI=1S/C28H30N2O3S/c1-6-7-16-30-22-11-9-8-10-21(22)18(3)25(30)26(31)29-27-24(28(32)33-5)23(19(4)34-27)20-14-12-17(2)13-15-20/h8-15H,6-7,16H2,1-5H3,(H,29,31) |
| InChIKey | OYRMQJRGXSDERP-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|