C22H23ClN2O3 — CID 110501319
methyl 3-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-chlorobenzoate (PubChem CID 110501319) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is methyl 3-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-chlorobenzoate.
| Compound Name | methyl 3-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 110501319 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | methyl 3-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-chlorobenzoate |
| SMILES | CCCCn1c(C(=O)Nc2cc(C(=O)OC)ccc2Cl)c(C)c2ccccc21 |
| InChI | InChI=1S/C22H23ClN2O3/c1-4-5-12-25-19-9-7-6-8-16(19)14(2)20(25)21(26)24-18-13-15(22(27)28-3)10-11-17(18)23/h6-11,13H,4-5,12H2,1-3H3,(H,24,26) |
| InChIKey | UYURGFQZLJXNDR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|