C27H35N3O3 — CID 110501276
2-(diethylamino)ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate (PubChem CID 110501276) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110501276 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(1-butyl-3-methylindole-2-carbonyl)amino]benzoate |
| SMILES | CCCCn1c(C(=O)Nc2ccc(C(=O)OCCN(CC)CC)cc2)c(C)c2ccccc21 |
| InChI | InChI=1S/C27H35N3O3/c1-5-8-17-30-24-12-10-9-11-23(24)20(4)25(30)26(31)28-22-15-13-21(14-16-22)27(32)33-19-18-29(6-2)7-3/h9-16H,5-8,17-19H2,1-4H3,(H,28,31) |
| InChIKey | YBUPLYKYRQDDEP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|