C23H26N4O4 — CID 2087793
2-(diethylamino)ethyl 4-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]benzoate (PubChem CID 2087793) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2087793 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(3-methyl-4-oxophthalazine-1-carbonyl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2nn(C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-4-27(5-2)14-15-31-23(30)16-10-12-17(13-11-16)24-21(28)20-18-8-6-7-9-19(18)22(29)26(3)25-20/h6-13H,4-5,14-15H2,1-3H3,(H,24,28) |
| InChIKey | VINZVKTXCKSHEI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |