C33H31N3O3 — CID 2336394
2-(diethylamino)ethyl 4-[(2-naphthalen-1-ylquinoline-4-carbonyl)amino]benzoate (PubChem CID 2336394) has the molecular formula C33H31N3O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[(2-naphthalen-1-ylquinoline-4-carbonyl)amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[(2-naphthalen-1-ylquinoline-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 2336394 |
| Molecular Formula | C33H31N3O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[(2-naphthalen-1-ylquinoline-4-carbonyl)amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)c2cc(-c3cccc4ccccc34)nc3ccccc23)cc1 |
| InChI | InChI=1S/C33H31N3O3/c1-3-36(4-2)20-21-39-33(38)24-16-18-25(19-17-24)34-32(37)29-22-31(35-30-15-8-7-13-28(29)30)27-14-9-11-23-10-5-6-12-26(23)27/h5-19,22H,3-4,20-21H2,1-2H3,(H,34,37) |
| InChIKey | IGKUMILQIKEDJR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |