C27H24N2O5 — CID 4580773
ethyl 4-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate (PubChem CID 4580773) has the molecular formula C27H24N2O5 and a molecular weight of 456.50 g/mol. Its IUPAC name is ethyl 4-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4580773 |
| Molecular Formula | C27H24N2O5 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | ethyl 4-[[2-(3,4-dimethoxyphenyl)quinoline-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(-c3ccc(OC)c(OC)c3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C27H24N2O5/c1-4-34-27(31)17-9-12-19(13-10-17)28-26(30)21-16-23(29-22-8-6-5-7-20(21)22)18-11-14-24(32-2)25(15-18)33-3/h5-16H,4H2,1-3H3,(H,28,30) |
| InChIKey | SHYLZQSLNZCAQA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |