C27H26N2O6 — CID 2161835
2-(3,4-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 2161835) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2161835 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3cc(OC)c(OC)c(OC)c3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C27H26N2O6/c1-31-22-11-10-16(12-23(22)32-2)21-15-19(18-8-6-7-9-20(18)29-21)27(30)28-17-13-24(33-3)26(35-5)25(14-17)34-4/h6-15H,1-5H3,(H,28,30) |
| InChIKey | WGGSQXHYEBENTB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |