C22H24N2O4 — CID 29198652
N-propan-2-yl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 29198652) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-propan-2-yl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-propan-2-yl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 29198652 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-propan-2-yl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)NC(C)C)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N2O4/c1-13(2)23-22(25)16-12-18(24-17-9-7-6-8-15(16)17)14-10-19(26-3)21(28-5)20(11-14)27-4/h6-13H,1-5H3,(H,23,25) |
| InChIKey | CAEZMDYNLCMNJF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |