C24H28N2O4 — CID 35139214
N-(3-methylbutyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 35139214) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(3-methylbutyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 35139214 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-(3-methylbutyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)NCCC(C)C)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28N2O4/c1-15(2)10-11-25-24(27)18-14-20(26-19-9-7-6-8-17(18)19)16-12-21(28-3)23(30-5)22(13-16)29-4/h6-9,12-15H,10-11H2,1-5H3,(H,25,27) |
| InChIKey | XLBPOSNQOOQPDY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |