C22H23NO6 — CID 32773013
2-methoxyethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 32773013) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-methoxyethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | 2-methoxyethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 32773013 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-methoxyethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COCCOC(=O)c1cc(-c2cc(OC)c(OC)c(OC)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H23NO6/c1-25-9-10-29-22(24)16-13-18(23-17-8-6-5-7-15(16)17)14-11-19(26-2)21(28-4)20(12-14)27-3/h5-8,11-13H,9-10H2,1-4H3 |
| InChIKey | BKIHDFZJCMEXCN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|