C26H23NO5 — CID 2366983
benzyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 2366983) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is benzyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | benzyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2366983 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | benzyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)OCc3ccccc3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H23NO5/c1-29-23-13-18(14-24(30-2)25(23)31-3)22-15-20(19-11-7-8-12-21(19)27-22)26(28)32-16-17-9-5-4-6-10-17/h4-15H,16H2,1-3H3 |
| InChIKey | WXWLXCGDKUCENJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |