C30H25NO5 — CID 3310095
naphthalen-1-ylmethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 3310095) has the molecular formula C30H25NO5 and a molecular weight of 479.53 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | naphthalen-1-ylmethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3310095 |
| Molecular Formula | C30H25NO5 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | naphthalen-1-ylmethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)OCc3cccc4ccccc34)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C30H25NO5/c1-33-27-15-21(16-28(34-2)29(27)35-3)26-17-24(23-13-6-7-14-25(23)31-26)30(32)36-18-20-11-8-10-19-9-4-5-12-22(19)20/h4-17H,18H2,1-3H3 |
| InChIKey | OTCFTMZHUONZFN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |