C27H24ClNO6 — CID 3916137
2-(4-chlorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 3916137) has the molecular formula C27H24ClNO6 and a molecular weight of 493.94 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3916137 |
| Molecular Formula | C27H24ClNO6 |
| Molecular Weight | 493.94 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)OCCOc3ccc(Cl)cc3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24ClNO6/c1-31-24-14-17(15-25(32-2)26(24)33-3)23-16-21(20-6-4-5-7-22(20)29-23)27(30)35-13-12-34-19-10-8-18(28)9-11-19/h4-11,14-16H,12-13H2,1-3H3 |
| InChIKey | MPQSEQHVWBPOID-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.94 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|