C24H20ClN3O4 — CID 39753706
N-(5-chloro-2-pyridinyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 39753706) has the molecular formula C24H20ClN3O4 and a molecular weight of 449.89 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 39753706 |
| Molecular Formula | C24H20ClN3O4 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)Nc3ccc(Cl)cn3)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C24H20ClN3O4/c1-30-20-10-14(11-21(31-2)23(20)32-3)19-12-17(16-6-4-5-7-18(16)27-19)24(29)28-22-9-8-15(25)13-26-22/h4-13H,1-3H3,(H,26,28,29) |
| InChIKey | WEHHDKLAISEYLU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |