C25H21BrN2O4 — CID 42993277
N-(2-bromophenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 42993277) has the molecular formula C25H21BrN2O4 and a molecular weight of 493.36 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42993277 |
| Molecular Formula | C25H21BrN2O4 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N-(2-bromophenyl)-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)Nc3ccccc3Br)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H21BrN2O4/c1-30-22-12-15(13-23(31-2)24(22)32-3)21-14-17(16-8-4-6-10-19(16)27-21)25(29)28-20-11-7-5-9-18(20)26/h4-14H,1-3H3,(H,28,29) |
| InChIKey | CRFCTZHVGXAPCR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |