C22H22N2O4 — CID 31012307
N-prop-2-enyl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide (PubChem CID 31012307) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-prop-2-enyl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-prop-2-enyl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 31012307 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-prop-2-enyl-2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxamide |
| SMILES | C=CCNC(=O)c1cc(-c2cc(OC)c(OC)c(OC)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H22N2O4/c1-5-10-23-22(25)16-13-18(24-17-9-7-6-8-15(16)17)14-11-19(26-2)21(28-4)20(12-14)27-3/h5-9,11-13H,1,10H2,2-4H3,(H,23,25) |
| InChIKey | NWTOBFRXNNCFMV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|