C25H25N3O7 — CID 35832021
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate (PubChem CID 35832021) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 35832021 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)c1cc(-c2cc(OC)c(OC)c(OC)c2)nc2ccccc12 |
| InChI | InChI=1S/C25H25N3O7/c1-5-10-26-25(31)28-22(29)14-35-24(30)17-13-19(27-18-9-7-6-8-16(17)18)15-11-20(32-2)23(34-4)21(12-15)33-3/h5-9,11-13H,1,10,14H2,2-4H3,(H2,26,28,29,31) |
| InChIKey | ZCAHSNRPMFQVNG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|