C23H22N2O3 — CID 3952785
[2-oxo-2-(prop-2-enylamino)ethyl] 2-(2,4-dimethylphenyl)quinoline-4-carboxylate (PubChem CID 3952785) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2-(2,4-dimethylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(2,4-dimethylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3952785 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(2,4-dimethylphenyl)quinoline-4-carboxylate |
| SMILES | C=CCNC(=O)COC(=O)c1cc(-c2ccc(C)cc2C)nc2ccccc12 |
| InChI | InChI=1S/C23H22N2O3/c1-4-11-24-22(26)14-28-23(27)19-13-21(17-10-9-15(2)12-16(17)3)25-20-8-6-5-7-18(19)20/h4-10,12-13H,1,11,14H2,2-3H3,(H,24,26) |
| InChIKey | UCEWKCPJJQSLJX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|