C22H18F2N2O4 — CID 2685057
[2-oxo-2-(prop-2-enylamino)ethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate (PubChem CID 2685057) has the molecular formula C22H18F2N2O4 and a molecular weight of 412.39 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2685057 |
| Molecular Formula | C22H18F2N2O4 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate |
| SMILES | C=CCNC(=O)COC(=O)c1cc(-c2ccc(OC(F)F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H18F2N2O4/c1-2-11-25-20(27)13-29-21(28)17-12-19(26-18-6-4-3-5-16(17)18)14-7-9-15(10-8-14)30-22(23)24/h2-10,12,22H,1,11,13H2,(H,25,27) |
| InChIKey | WKTLEJNBNAMYQR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|