C28H17F2N3O4S — CID 135535973
[(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate (PubChem CID 135535973) has the molecular formula C28H17F2N3O4S and a molecular weight of 529.52 g/mol. Its IUPAC name is [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate.
| Compound Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 135535973 |
| Molecular Formula | C28H17F2N3O4S |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[4-(difluoromethoxy)phenyl]quinoline-4-carboxylate |
| SMILES | N#C/C(=C(/O)COC(=O)c1cc(-c2ccc(OC(F)F)cc2)nc2ccccc12)c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H17F2N3O4S/c29-28(30)37-17-11-9-16(10-12-17)23-13-19(18-5-1-2-6-21(18)32-23)27(35)36-15-24(34)20(14-31)26-33-22-7-3-4-8-25(22)38-26/h1-13,28,34H,15H2/b24-20- |
| InChIKey | NASWHKLUPNOCGB-GFMRDNFCSA-N |
| XLogP | 6.76 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|