C22H20N2O3S — CID 2339100
[3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-tert-butylbenzoate (PubChem CID 2339100) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-tert-butylbenzoate.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2339100 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCC(O)=C(C#N)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-22(2,3)15-10-8-14(9-11-15)21(26)27-13-18(25)16(12-23)20-24-17-6-4-5-7-19(17)28-20/h4-11,25H,13H2,1-3H3 |
| InChIKey | REYGJKCQBIGJFX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|