C22H13N3O5S — CID 135676394
[(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 135676394) has the molecular formula C22H13N3O5S and a molecular weight of 431.43 g/mol. Its IUPAC name is [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate.
| Compound Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 135676394 |
| Molecular Formula | C22H13N3O5S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | [(Z)-3-(1,3-benzothiazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate |
| SMILES | N#C/C(=C(/O)COC(=O)/C(C#N)=C/c1ccc2c(c1)OCO2)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H13N3O5S/c23-9-14(7-13-5-6-18-19(8-13)30-12-29-18)22(27)28-11-17(26)15(10-24)21-25-16-3-1-2-4-20(16)31-21/h1-8,26H,11-12H2/b14-7+,17-15- |
| InChIKey | WDBXYQDFUORBET-GFEVEYBRSA-N |
| XLogP | 3.97 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|