methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate

C12H9NO4 — CID 768567

IUPACmethyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate
SMILESCOC(=O)/C(C#N)=C/c1ccc2c(c1)OCO2
InChIInChI=1S/C12H9NO4/c1-15-12(14)9(6-13)4-8-2-3-10-11(5-8)17-7-16-10/h2-5H,7H2,1H3/b9-4+
InChIKeyIUOSQCONBLAUEC-RUDMXATFSA-N
MW231.21 g/mol
LogP1.50
Rot. Bonds2

About methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate

methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate (PubChem CID 768567) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate.

Molecular Properties

Compound Namemethyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate
PubChem CID768567
Molecular FormulaC12H9NO4
Molecular Weight231.21 g/mol
Exact Mass231.05
IUPAC Namemethyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate
SMILESCOC(=O)/C(C#N)=C/c1ccc2c(c1)OCO2
InChIInChI=1S/C12H9NO4/c1-15-12(14)9(6-13)4-8-2-3-10-11(5-8)17-7-16-10/h2-5H,7H2,1H3/b9-4+
InChIKeyIUOSQCONBLAUEC-RUDMXATFSA-N
XLogP1.50
TPSA68.55 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.21
LogP ≤ 51.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate?
The IUPAC name of methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate (CID 768567) is methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate.
What is the SMILES notation for methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate?
The canonical SMILES for methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate is COC(=O)/C(C#N)=C/c1ccc2c(c1)OCO2.
What is the InChIKey of methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate?
The InChIKey is IUOSQCONBLAUEC-RUDMXATFSA-N. The full InChI is InChI=1S/C12H9NO4/c1-15-12(14)9(6-13)4-8-2-3-10-11(5-8)17-7-16-10/h2-5H,7H2,1H3/b9-4+.
What are the key properties of methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate?
methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate has a molecular weight of 231.21 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoate is sourced from PubChem (CID 768567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).