C19H15NO5 — CID 47046491
(Z)-2-(1,3-benzodioxole-5-carbonyl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 47046491) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxole-5-carbonyl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzodioxole-5-carbonyl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 47046491 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (Z)-2-(1,3-benzodioxole-5-carbonyl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)C(=O)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C19H15NO5/c1-22-15-5-3-12(8-17(15)23-2)7-14(10-20)19(21)13-4-6-16-18(9-13)25-11-24-16/h3-9H,11H2,1-2H3/b14-7- |
| InChIKey | HXRGSICZLRTDDB-AUWJEWJLSA-N |
| XLogP | 3.22 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|