C18H16O6 — CID 83955527
(Z)-2-(1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 83955527) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is (Z)-2-(1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83955527 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (Z)-2-(1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(\C(=O)O)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C18H16O6/c1-21-14-5-3-11(8-16(14)22-2)7-13(18(19)20)12-4-6-15-17(9-12)24-10-23-15/h3-9H,10H2,1-2H3,(H,19,20)/b13-7- |
| InChIKey | MQQMENQBJZVKDE-QPEQYQDCSA-N |
| XLogP | 3.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|