C17H15BrO4 — CID 1265001
(Z)-3-(4-bromophenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 1265001) has the molecular formula C17H15BrO4 and a molecular weight of 363.21 g/mol. Its IUPAC name is (Z)-3-(4-bromophenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-bromophenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 1265001 |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (Z)-3-(4-bromophenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/c2ccc(Br)cc2)C(=O)O)cc1OC |
| InChI | InChI=1S/C17H15BrO4/c1-21-15-8-5-12(10-16(15)22-2)14(17(19)20)9-11-3-6-13(18)7-4-11/h3-10H,1-2H3,(H,19,20)/b14-9- |
| InChIKey | JXWLFHCYMPUNFL-ZROIWOOFSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|