C18H17ClO3 — CID 83953226
(Z)-2-(3-chloro-4-methoxyphenyl)-3-(4-ethylphenyl)prop-2-enoic acid (PubChem CID 83953226) has the molecular formula C18H17ClO3 and a molecular weight of 316.78 g/mol. Its IUPAC name is (Z)-2-(3-chloro-4-methoxyphenyl)-3-(4-ethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(3-chloro-4-methoxyphenyl)-3-(4-ethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83953226 |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (Z)-2-(3-chloro-4-methoxyphenyl)-3-(4-ethylphenyl)prop-2-enoic acid |
| SMILES | CCc1ccc(/C=C(\C(=O)O)c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H17ClO3/c1-3-12-4-6-13(7-5-12)10-15(18(20)21)14-8-9-17(22-2)16(19)11-14/h4-11H,3H2,1-2H3,(H,20,21)/b15-10- |
| InChIKey | ZMZFZECXFOXKQQ-GDNBJRDFSA-N |
| XLogP | 4.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|