C19H19ClO4 — CID 112720011
(Z)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-ethylphenyl)prop-2-enoic acid (PubChem CID 112720011) has the molecular formula C19H19ClO4 and a molecular weight of 346.81 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-ethylphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-ethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 112720011 |
| Molecular Formula | C19H19ClO4 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (Z)-3-(3-chloro-4,5-dimethoxyphenyl)-2-(4-ethylphenyl)prop-2-enoic acid |
| SMILES | CCc1ccc(/C(=C/c2cc(Cl)c(OC)c(OC)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H19ClO4/c1-4-12-5-7-14(8-6-12)15(19(21)22)9-13-10-16(20)18(24-3)17(11-13)23-2/h5-11H,4H2,1-3H3,(H,21,22)/b15-9- |
| InChIKey | DTCJTOBXOBBRDK-DHDCSXOGSA-N |
| XLogP | 4.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|