C16H12Cl2O4 — CID 83953085
(Z)-3-(3,5-dichloro-4-methoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid (PubChem CID 83953085) has the molecular formula C16H12Cl2O4 and a molecular weight of 339.17 g/mol. Its IUPAC name is (Z)-3-(3,5-dichloro-4-methoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(3,5-dichloro-4-methoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83953085 |
| Molecular Formula | C16H12Cl2O4 |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | (Z)-3-(3,5-dichloro-4-methoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid |
| SMILES | COc1c(Cl)cc(/C=C(\C(=O)O)c2cccc(O)c2)cc1Cl |
| InChI | InChI=1S/C16H12Cl2O4/c1-22-15-13(17)6-9(7-14(15)18)5-12(16(20)21)10-3-2-4-11(19)8-10/h2-8,19H,1H3,(H,20,21)/b12-5- |
| InChIKey | CEZJAHUBCJWKAY-XGICHPGQSA-N |
| XLogP | 4.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|