C17H16O6 — CID 83950818
(Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid (PubChem CID 83950818) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83950818 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C(\C(=O)O)c2cccc(O)c2)cc(OC)c1O |
| InChI | InChI=1S/C17H16O6/c1-22-14-7-10(8-15(23-2)16(14)19)6-13(17(20)21)11-4-3-5-12(18)9-11/h3-9,18-19H,1-2H3,(H,20,21)/b13-6- |
| InChIKey | WRNKHUPLQLBNMT-MLPAPPSSSA-N |
| XLogP | 2.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|