C15H10I2O3 — CID 23619429
(E)-3-(4-hydroxy-3,5-diiodophenyl)-2-phenylprop-2-enoic acid (PubChem CID 23619429) has the molecular formula C15H10I2O3 and a molecular weight of 492.05 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3,5-diiodophenyl)-2-phenylprop-2-enoic acid.
| Compound Name | (E)-3-(4-hydroxy-3,5-diiodophenyl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 23619429 |
| Molecular Formula | C15H10I2O3 |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.87 |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-diiodophenyl)-2-phenylprop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cc(I)c(O)c(I)c1)c1ccccc1 |
| InChI | InChI=1S/C15H10I2O3/c16-12-7-9(8-13(17)14(12)18)6-11(15(19)20)10-4-2-1-3-5-10/h1-8,18H,(H,19,20)/b11-6+ |
| InChIKey | XHJGWIGENJUFRC-IZZDOVSWSA-N |
| XLogP | 4.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|