C16H9I2NO2 — CID 21381872
(E)-2-benzoyl-3-(4-hydroxy-3,5-diiodophenyl)prop-2-enenitrile (PubChem CID 21381872) has the molecular formula C16H9I2NO2 and a molecular weight of 501.06 g/mol. Its IUPAC name is (E)-2-benzoyl-3-(4-hydroxy-3,5-diiodophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-(4-hydroxy-3,5-diiodophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21381872 |
| Molecular Formula | C16H9I2NO2 |
| Molecular Weight | 501.06 g/mol |
| Exact Mass | 500.87 |
| IUPAC Name | (E)-2-benzoyl-3-(4-hydroxy-3,5-diiodophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(I)c(O)c(I)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H9I2NO2/c17-13-7-10(8-14(18)16(13)21)6-12(9-19)15(20)11-4-2-1-3-5-11/h1-8,21H/b12-6+ |
| InChIKey | KHCNJIGFASMOKK-WUXMJOGZSA-N |
| XLogP | 4.39 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.06 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|