C19H15I2NO2 — CID 21381978
(E)-2-benzoyl-3-(3,5-diiodo-4-propan-2-yloxyphenyl)prop-2-enenitrile (PubChem CID 21381978) has the molecular formula C19H15I2NO2 and a molecular weight of 543.14 g/mol. Its IUPAC name is (E)-2-benzoyl-3-(3,5-diiodo-4-propan-2-yloxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-(3,5-diiodo-4-propan-2-yloxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21381978 |
| Molecular Formula | C19H15I2NO2 |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 542.92 |
| IUPAC Name | (E)-2-benzoyl-3-(3,5-diiodo-4-propan-2-yloxyphenyl)prop-2-enenitrile |
| SMILES | CC(C)Oc1c(I)cc(/C=C(\C#N)C(=O)c2ccccc2)cc1I |
| InChI | InChI=1S/C19H15I2NO2/c1-12(2)24-19-16(20)9-13(10-17(19)21)8-15(11-22)18(23)14-6-4-3-5-7-14/h3-10,12H,1-2H3/b15-8+ |
| InChIKey | RFAVRLICFHHZBR-OVCLIPMQSA-N |
| XLogP | 5.47 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|