C19H13Br2NO2 — CID 3481219
2-benzoyl-3-(3,5-dibromo-4-prop-2-enoxyphenyl)prop-2-enenitrile (PubChem CID 3481219) has the molecular formula C19H13Br2NO2 and a molecular weight of 447.13 g/mol. Its IUPAC name is 2-benzoyl-3-(3,5-dibromo-4-prop-2-enoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-benzoyl-3-(3,5-dibromo-4-prop-2-enoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3481219 |
| Molecular Formula | C19H13Br2NO2 |
| Molecular Weight | 447.13 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | 2-benzoyl-3-(3,5-dibromo-4-prop-2-enoxyphenyl)prop-2-enenitrile |
| SMILES | C=CCOc1c(Br)cc(C=C(C#N)C(=O)c2ccccc2)cc1Br |
| InChI | InChI=1S/C19H13Br2NO2/c1-2-8-24-19-16(20)10-13(11-17(19)21)9-15(12-22)18(23)14-6-4-3-5-7-14/h2-7,9-11H,1,8H2 |
| InChIKey | VUIUGWUDFJFNOX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.13 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|