C21H17BrN2O5 — CID 24582761
4-[[(E)-3-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 24582761) has the molecular formula C21H17BrN2O5 and a molecular weight of 457.28 g/mol. Its IUPAC name is 4-[[(E)-3-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-3-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 24582761 |
| Molecular Formula | C21H17BrN2O5 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 4-[[(E)-3-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | C=CCOc1c(Br)cc(/C=C(\C#N)C(=O)Nc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C21H17BrN2O5/c1-3-8-29-19-17(22)10-13(11-18(19)28-2)9-15(12-23)20(25)24-16-6-4-14(5-7-16)21(26)27/h3-7,9-11H,1,8H2,2H3,(H,24,25)(H,26,27)/b15-9+ |
| InChIKey | NRDWPRVLFCGDJX-OQLLNIDSSA-N |
| XLogP | 4.27 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|