C21H18BrN3O6 — CID 126223904
methyl 4-[[(E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 126223904) has the molecular formula C21H18BrN3O6 and a molecular weight of 488.29 g/mol. Its IUPAC name is methyl 4-[[(E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126223904 |
| Molecular Formula | C21H18BrN3O6 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | methyl 4-[[(E)-3-[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(C#N)=C/c2cc(Br)c(OCC(N)=O)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H18BrN3O6/c1-29-17-9-12(8-16(22)19(17)31-11-18(24)26)7-14(10-23)20(27)25-15-5-3-13(4-6-15)21(28)30-2/h3-9H,11H2,1-2H3,(H2,24,26)(H,25,27)/b14-7+ |
| InChIKey | AEEQIEFOUNIHEZ-VGOFMYFVSA-N |
| XLogP | 2.65 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|