C18H12Br2N2O3 — CID 4000516
3-(3,5-dibromo-4-prop-2-enoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 4000516) has the molecular formula C18H12Br2N2O3 and a molecular weight of 464.11 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-prop-2-enoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(3,5-dibromo-4-prop-2-enoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4000516 |
| Molecular Formula | C18H12Br2N2O3 |
| Molecular Weight | 464.11 g/mol |
| Exact Mass | 461.92 |
| IUPAC Name | 3-(3,5-dibromo-4-prop-2-enoxyphenyl)-2-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | C=CCOc1c(Br)cc(C=C(C#N)c2cccc([N+](=O)[O-])c2)cc1Br |
| InChI | InChI=1S/C18H12Br2N2O3/c1-2-6-25-18-16(19)8-12(9-17(18)20)7-14(11-21)13-4-3-5-15(10-13)22(23)24/h2-5,7-10H,1,6H2 |
| InChIKey | YJPIGGYJNHQHDD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.11 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|