C22H14Br2N2O3 — CID 126061462
(Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126061462) has the molecular formula C22H14Br2N2O3 and a molecular weight of 514.17 g/mol. Its IUPAC name is (Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126061462 |
| Molecular Formula | C22H14Br2N2O3 |
| Molecular Weight | 514.17 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | (Z)-3-(3,5-dibromo-4-phenylmethoxyphenyl)-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)c(OCc2ccccc2)c(Br)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H14Br2N2O3/c23-20-11-16(10-18(13-25)17-6-8-19(9-7-17)26(27)28)12-21(24)22(20)29-14-15-4-2-1-3-5-15/h1-12H,14H2/b18-10+ |
| InChIKey | HXTKXHCLCUXIDF-VCHYOVAHSA-N |
| XLogP | 6.76 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.17 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|