C23H14Br2N2O5 — CID 126366105
(E)-2-(1,3-benzodioxol-5-yl)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 126366105) has the molecular formula C23H14Br2N2O5 and a molecular weight of 558.18 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126366105 |
| Molecular Formula | C23H14Br2N2O5 |
| Molecular Weight | 558.18 g/mol |
| Exact Mass | 555.93 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H14Br2N2O5/c24-19-8-15(7-17(11-26)16-3-6-21-22(10-16)32-13-31-21)9-20(25)23(19)30-12-14-1-4-18(5-2-14)27(28)29/h1-10H,12-13H2/b17-7- |
| InChIKey | GTRRLWSPJNKEJZ-IDUWFGFVSA-N |
| XLogP | 6.49 |
| TPSA | 94.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.18 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|