C16H10N2O4 — CID 126366430
(E)-2-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 126366430) has the molecular formula C16H10N2O4 and a molecular weight of 294.27 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126366430 |
| Molecular Formula | C16H10N2O4 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (E)-2-(1,3-benzodioxol-5-yl)-3-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cccc([N+](=O)[O-])c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H10N2O4/c17-9-13(6-11-2-1-3-14(7-11)18(19)20)12-4-5-15-16(8-12)22-10-21-15/h1-8H,10H2/b13-6- |
| InChIKey | HLHHPNKNZOLMCK-MLPAPPSSSA-N |
| XLogP | 3.39 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|