C23H15NO4 — CID 39115018
[3-[(E)-2-cyano-2-phenylethenyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 39115018) has the molecular formula C23H15NO4 and a molecular weight of 369.38 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 39115018 |
| Molecular Formula | C23H15NO4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)c2ccc3c(c2)OCO3)c1)c1ccccc1 |
| InChI | InChI=1S/C23H15NO4/c24-14-19(17-6-2-1-3-7-17)11-16-5-4-8-20(12-16)28-23(25)18-9-10-21-22(13-18)27-15-26-21/h1-13H,15H2/b19-11- |
| InChIKey | XVCMSDZATOYQQF-ODLFYWEKSA-N |
| XLogP | 4.70 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|