C22H12Cl3NO2 — CID 39115430
[3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3,4-dichlorobenzoate (PubChem CID 39115430) has the molecular formula C22H12Cl3NO2 and a molecular weight of 428.70 g/mol. Its IUPAC name is [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3,4-dichlorobenzoate.
| Compound Name | [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 39115430 |
| Molecular Formula | C22H12Cl3NO2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3,4-dichlorobenzoate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)c2ccc(Cl)c(Cl)c2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H12Cl3NO2/c23-18-7-4-15(5-8-18)17(13-26)10-14-2-1-3-19(11-14)28-22(27)16-6-9-20(24)21(25)12-16/h1-12H/b17-10- |
| InChIKey | ZWELQYAPRCZZSW-YVLHZVERSA-N |
| XLogP | 6.93 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|