C24H24ClNO2 — CID 39115479
[3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3-cyclohexylpropanoate (PubChem CID 39115479) has the molecular formula C24H24ClNO2 and a molecular weight of 393.91 g/mol. Its IUPAC name is [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3-cyclohexylpropanoate.
| Compound Name | [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 39115479 |
| Molecular Formula | C24H24ClNO2 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 3-cyclohexylpropanoate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)CCC2CCCCC2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClNO2/c25-22-12-10-20(11-13-22)21(17-26)15-19-7-4-8-23(16-19)28-24(27)14-9-18-5-2-1-3-6-18/h4,7-8,10-13,15-16,18H,1-3,5-6,9,14H2/b21-15- |
| InChIKey | JVEMLSYRSCHRMD-QNGOZBTKSA-N |
| XLogP | 6.67 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|