About [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate
[3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate (PubChem CID 39114997) has the molecular formula C23H17NO2
and a molecular weight of 339.39 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate |
| PubChem CID | 39114997 |
| Molecular Formula | C23H17NO2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)Cc2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H17NO2/c24-17-21(20-11-5-2-6-12-20)14-19-10-7-13-22(15-19)26-23(25)16-18-8-3-1-4-9-18/h1-15H,16H2/b21-14- |
| InChIKey | AEMHXYTTWXAQFV-STZFKDTASA-N |
| XLogP | 4.90 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate?
The IUPAC name of [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate (CID 39114997) is [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate.
What is the SMILES notation for [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate?
The canonical SMILES for [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate is N#C/C(=C/c1cccc(OC(=O)Cc2ccccc2)c1)c1ccccc1.
What is the InChIKey of [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate?
The InChIKey is AEMHXYTTWXAQFV-STZFKDTASA-N. The full InChI is InChI=1S/C23H17NO2/c24-17-21(20-11-5-2-6-12-20)14-19-10-7-13-22(15-19)26-23(25)16-18-8-3-1-4-9-18/h1-15H,16H2/b21-14-.
What are the key properties of [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate?
[3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate has a molecular weight of 339.39 g/mol, XLogP of 4.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 2-phenylacetate is sourced from PubChem (CID 39114997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).