About [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate
[3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate (PubChem CID 39115519) has the molecular formula C18H14ClNO3
and a molecular weight of 327.77 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate.
Molecular Properties
| Compound Name | [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate |
| PubChem CID | 39115519 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate |
| SMILES | COc1ccc(/C(C#N)=C\c2cccc(OC(=O)CCl)c2)cc1 |
| InChI | InChI=1S/C18H14ClNO3/c1-22-16-7-5-14(6-8-16)15(12-20)9-13-3-2-4-17(10-13)23-18(21)11-19/h2-10H,11H2,1H3/b15-9- |
| InChIKey | GMUXBGWNADHIKL-DHDCSXOGSA-N |
| XLogP | 3.90 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate?
The IUPAC name of [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate (CID 39115519) is [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate.
What is the SMILES notation for [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate?
The canonical SMILES for [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate is COc1ccc(/C(C#N)=C\c2cccc(OC(=O)CCl)c2)cc1.
What is the InChIKey of [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate?
The InChIKey is GMUXBGWNADHIKL-DHDCSXOGSA-N. The full InChI is InChI=1S/C18H14ClNO3/c1-22-16-7-5-14(6-8-16)15(12-20)9-13-3-2-4-17(10-13)23-18(21)11-19/h2-10H,11H2,1H3/b15-9-.
What are the key properties of [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate?
[3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate has a molecular weight of 327.77 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-chloroacetate is sourced from PubChem (CID 39115519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).