C24H12Cl4N2 — CID 4089006
2-[4-[1-cyano-2-(3,4-dichlorophenyl)ethenyl]phenyl]-3-(3,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 4089006) has the molecular formula C24H12Cl4N2 and a molecular weight of 470.19 g/mol. Its IUPAC name is 2-[4-[1-cyano-2-(3,4-dichlorophenyl)ethenyl]phenyl]-3-(3,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | 2-[4-[1-cyano-2-(3,4-dichlorophenyl)ethenyl]phenyl]-3-(3,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4089006 |
| Molecular Formula | C24H12Cl4N2 |
| Molecular Weight | 470.19 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | 2-[4-[1-cyano-2-(3,4-dichlorophenyl)ethenyl]phenyl]-3-(3,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Cl)c(Cl)c1)c1ccc(C(C#N)=Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H12Cl4N2/c25-21-7-1-15(11-23(21)27)9-19(13-29)17-3-5-18(6-4-17)20(14-30)10-16-2-8-22(26)24(28)12-16/h1-12H |
| InChIKey | FFYJSNGBGREIBE-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.19 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|