C13H7Cl2NS — CID 5378071
(E)-3-(3,4-dichlorophenyl)-2-thiophen-2-ylprop-2-enenitrile (PubChem CID 5378071) has the molecular formula C13H7Cl2NS and a molecular weight of 280.18 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-2-thiophen-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-2-thiophen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 5378071 |
| Molecular Formula | C13H7Cl2NS |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-2-thiophen-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C13H7Cl2NS/c14-11-4-3-9(7-12(11)15)6-10(8-16)13-2-1-5-17-13/h1-7H/b10-6+ |
| InChIKey | SCZUOCFBCPROIJ-UXBLZVDNSA-N |
| XLogP | 5.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|