C17H11Cl2N3 — CID 18292390
(E)-3-(3,4-dichlorophenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile (PubChem CID 18292390) has the molecular formula C17H11Cl2N3 and a molecular weight of 328.20 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 18292390 |
| Molecular Formula | C17H11Cl2N3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-2-(1-methylbenzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cn1c(/C(C#N)=C/c2ccc(Cl)c(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C17H11Cl2N3/c1-22-16-5-3-2-4-15(16)21-17(22)12(10-20)8-11-6-7-13(18)14(19)9-11/h2-9H,1H3/b12-8+ |
| InChIKey | JBTRZMCEHCARMB-XYOKQWHBSA-N |
| XLogP | 4.94 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|